About 2-[1-[4-[4-(1,2,4-triazol-1-yl)phenoxy]phenoxy]propan-2-yloxy]pyridine
2-[1-[4-[4-(1,2,4-triazol-1-yl)phenoxy]phenoxy]propan-2-yloxy]pyridine (PubChem CID 155936378) has the molecular formula C22H20N4O3
and a molecular weight of 388.43 g/mol. Its IUPAC name is 2-[1-[4-[4-(1,2,4-triazol-1-yl)phenoxy]phenoxy]propan-2-yloxy]pyridine.
Molecular Properties
| Compound Name | 2-[1-[4-[4-(1,2,4-triazol-1-yl)phenoxy]phenoxy]propan-2-yloxy]pyridine |
| PubChem CID | 155936378 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 2-[1-[4-[4-(1,2,4-triazol-1-yl)phenoxy]phenoxy]propan-2-yloxy]pyridine |
| SMILES | CC(COc1ccc(Oc2ccc(-n3cncn3)cc2)cc1)Oc1ccccn1 |
| InChI | InChI=1S/C22H20N4O3/c1-17(28-22-4-2-3-13-24-22)14-27-19-9-11-21(12-10-19)29-20-7-5-18(6-8-20)26-16-23-15-25-26/h2-13,15-17H,14H2,1H3 |
| InChIKey | CMJWHLDZVQIYCX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 71.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[1-[4-[4-(1,2,4-triazol-1-yl)phenoxy]phenoxy]propan-2-yloxy]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[4-[4-(1,2,4-triazol-1-yl)phenoxy]phenoxy]propan-2-yloxy]pyridine?
The IUPAC name of 2-[1-[4-[4-(1,2,4-triazol-1-yl)phenoxy]phenoxy]propan-2-yloxy]pyridine (CID 155936378) is 2-[1-[4-[4-(1,2,4-triazol-1-yl)phenoxy]phenoxy]propan-2-yloxy]pyridine.
What is the SMILES notation for 2-[1-[4-[4-(1,2,4-triazol-1-yl)phenoxy]phenoxy]propan-2-yloxy]pyridine?
The canonical SMILES for 2-[1-[4-[4-(1,2,4-triazol-1-yl)phenoxy]phenoxy]propan-2-yloxy]pyridine is CC(COc1ccc(Oc2ccc(-n3cncn3)cc2)cc1)Oc1ccccn1.
What is the InChIKey of 2-[1-[4-[4-(1,2,4-triazol-1-yl)phenoxy]phenoxy]propan-2-yloxy]pyridine?
The InChIKey is CMJWHLDZVQIYCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N4O3/c1-17(28-22-4-2-3-13-24-22)14-27-19-9-11-21(12-10-19)29-20-7-5-18(6-8-20)26-16-23-15-25-26/h2-13,15-17H,14H2,1H3.
What are the key properties of 2-[1-[4-[4-(1,2,4-triazol-1-yl)phenoxy]phenoxy]propan-2-yloxy]pyridine?
2-[1-[4-[4-(1,2,4-triazol-1-yl)phenoxy]phenoxy]propan-2-yloxy]pyridine has a molecular weight of 388.43 g/mol, XLogP of 4.30, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[4-[4-(1,2,4-triazol-1-yl)phenoxy]phenoxy]propan-2-yloxy]pyridine is sourced from PubChem (CID 155936378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).