C11H20N2O — CID 155936408
1-pentyl-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-a]imidazol-2-one (PubChem CID 155936408) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is 1-pentyl-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-a]imidazol-2-one.
| Compound Name | 1-pentyl-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-a]imidazol-2-one |
|---|---|
| PubChem CID | 155936408 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 1-pentyl-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-a]imidazol-2-one |
| SMILES | CCCCCN1C(=O)CN2CCCC21 |
| InChI | InChI=1S/C11H20N2O/c1-2-3-4-8-13-10-6-5-7-12(10)9-11(13)14/h10H,2-9H2,1H3 |
| InChIKey | QIAQXDDDRBXIJI-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|