C14H10N4O2 — CID 155936500
6-methoxy-2,8,12,13-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),2,4,6,11(15),13,16-heptaen-9-one (PubChem CID 155936500) has the molecular formula C14H10N4O2 and a molecular weight of 266.26 g/mol. Its IUPAC name is 6-methoxy-2,8,12,13-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),2,4,6,11(15),13,16-heptaen-9-one.
| Compound Name | 6-methoxy-2,8,12,13-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),2,4,6,11(15),13,16-heptaen-9-one |
|---|---|
| PubChem CID | 155936500 |
| Molecular Formula | C14H10N4O2 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 6-methoxy-2,8,12,13-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),2,4,6,11(15),13,16-heptaen-9-one |
| SMILES | COc1ccc2nc3ccc4cn[nH]c4c3c(=O)n2c1 |
| InChI | InChI=1S/C14H10N4O2/c1-20-9-3-5-11-16-10-4-2-8-6-15-17-13(8)12(10)14(19)18(11)7-9/h2-7H,1H3,(H,15,17) |
| InChIKey | GJEOPHHNVONBOW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|