C26H18BrN3O — CID 155936627
[(7S,8R)-8-(4-bromophenyl)-6,9,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),2,4,10,12,14-hexaen-7-yl]-phenylmethanone (PubChem CID 155936627) has the molecular formula C26H18BrN3O and a molecular weight of 468.35 g/mol. Its IUPAC name is [(7S,8R)-8-(4-bromophenyl)-6,9,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),2,4,10,12,14-hexaen-7-yl]-phenylmethanone.
| Compound Name | [(7S,8R)-8-(4-bromophenyl)-6,9,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),2,4,10,12,14-hexaen-7-yl]-phenylmethanone |
|---|---|
| PubChem CID | 155936627 |
| Molecular Formula | C26H18BrN3O |
| Molecular Weight | 468.35 g/mol |
| Exact Mass | 467.06 |
| IUPAC Name | [(7S,8R)-8-(4-bromophenyl)-6,9,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),2,4,10,12,14-hexaen-7-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)[C@@H]1[C@@H](c2ccc(Br)cc2)n2c(nc3ccccc32)-c2cccn21 |
| InChI | InChI=1S/C26H18BrN3O/c27-19-14-12-17(13-15-19)23-24(25(31)18-7-2-1-3-8-18)29-16-6-11-22(29)26-28-20-9-4-5-10-21(20)30(23)26/h1-16,23-24H/t23-,24+/m1/s1 |
| InChIKey | JZUZTUASORSMNG-RPWUZVMVSA-N |
| XLogP | 6.29 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.35 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |