About (1S)-1-(1-benzothiophen-5-yl)-N,N-dibenzylethanamine
(1S)-1-(1-benzothiophen-5-yl)-N,N-dibenzylethanamine (PubChem CID 155936660) has the molecular formula C24H23NS
and a molecular weight of 357.52 g/mol. Its IUPAC name is (1S)-1-(1-benzothiophen-5-yl)-N,N-dibenzylethanamine.
Molecular Properties
| Compound Name | (1S)-1-(1-benzothiophen-5-yl)-N,N-dibenzylethanamine |
| PubChem CID | 155936660 |
| Molecular Formula | C24H23NS |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | (1S)-1-(1-benzothiophen-5-yl)-N,N-dibenzylethanamine |
| SMILES | C[C@@H](c1ccc2sccc2c1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H23NS/c1-19(22-12-13-24-23(16-22)14-15-26-24)25(17-20-8-4-2-5-9-20)18-21-10-6-3-7-11-21/h2-16,19H,17-18H2,1H3/t19-/m0/s1 |
| InChIKey | WATQUKJGLSAQDB-IBGZPJMESA-N |
| XLogP | 6.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S)-1-(1-benzothiophen-5-yl)-N,N-dibenzylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-(1-benzothiophen-5-yl)-N,N-dibenzylethanamine?
The IUPAC name of (1S)-1-(1-benzothiophen-5-yl)-N,N-dibenzylethanamine (CID 155936660) is (1S)-1-(1-benzothiophen-5-yl)-N,N-dibenzylethanamine.
What is the SMILES notation for (1S)-1-(1-benzothiophen-5-yl)-N,N-dibenzylethanamine?
The canonical SMILES for (1S)-1-(1-benzothiophen-5-yl)-N,N-dibenzylethanamine is C[C@@H](c1ccc2sccc2c1)N(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of (1S)-1-(1-benzothiophen-5-yl)-N,N-dibenzylethanamine?
The InChIKey is WATQUKJGLSAQDB-IBGZPJMESA-N. The full InChI is InChI=1S/C24H23NS/c1-19(22-12-13-24-23(16-22)14-15-26-24)25(17-20-8-4-2-5-9-20)18-21-10-6-3-7-11-21/h2-16,19H,17-18H2,1H3/t19-/m0/s1.
What are the key properties of (1S)-1-(1-benzothiophen-5-yl)-N,N-dibenzylethanamine?
(1S)-1-(1-benzothiophen-5-yl)-N,N-dibenzylethanamine has a molecular weight of 357.52 g/mol, XLogP of 6.66, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-(1-benzothiophen-5-yl)-N,N-dibenzylethanamine is sourced from PubChem (CID 155936660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).