C17H20O2 — CID 155936762
(1'R,3'aR,7'aR)-1'-phenylspiro[1,3-dioxolane-2,6'-1,3a,4,5,7,7a-hexahydroindene] (PubChem CID 155936762) has the molecular formula C17H20O2 and a molecular weight of 256.35 g/mol. Its IUPAC name is (1'R,3'aR,7'aR)-1'-phenylspiro[1,3-dioxolane-2,6'-1,3a,4,5,7,7a-hexahydroindene].
| Compound Name | (1'R,3'aR,7'aR)-1'-phenylspiro[1,3-dioxolane-2,6'-1,3a,4,5,7,7a-hexahydroindene] |
|---|---|
| PubChem CID | 155936762 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | (1'R,3'aR,7'aR)-1'-phenylspiro[1,3-dioxolane-2,6'-1,3a,4,5,7,7a-hexahydroindene] |
| SMILES | C1=C[C@@H](c2ccccc2)[C@@H]2CC3(CC[C@H]12)OCCO3 |
| InChI | InChI=1S/C17H20O2/c1-2-4-13(5-3-1)15-7-6-14-8-9-17(12-16(14)15)18-10-11-19-17/h1-7,14-16H,8-12H2/t14-,15-,16+/m0/s1 |
| InChIKey | CHVRLRPPOFFSBX-HRCADAONSA-N |
| XLogP | 3.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|