C9H4ClFN2O2S — CID 15593692
3-chloro-5-(4-fluorophenoxy)-1,2,6-thiadiazin-4-one (PubChem CID 15593692) has the molecular formula C9H4ClFN2O2S and a molecular weight of 258.66 g/mol. Its IUPAC name is 3-chloro-5-(4-fluorophenoxy)-1,2,6-thiadiazin-4-one.
| Compound Name | 3-chloro-5-(4-fluorophenoxy)-1,2,6-thiadiazin-4-one |
|---|---|
| PubChem CID | 15593692 |
| Molecular Formula | C9H4ClFN2O2S |
| Molecular Weight | 258.66 g/mol |
| Exact Mass | 257.97 |
| IUPAC Name | 3-chloro-5-(4-fluorophenoxy)-1,2,6-thiadiazin-4-one |
| SMILES | O=c1c(Cl)nsnc1Oc1ccc(F)cc1 |
| InChI | InChI=1S/C9H4ClFN2O2S/c10-8-7(14)9(13-16-12-8)15-6-3-1-5(11)2-4-6/h1-4H |
| InChIKey | OTEPYPOPOOKCQY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.66 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |