C23H20FNO3S — CID 155937095
(3R)-1-benzyl-3-(4-fluorophenyl)sulfonyl-3-methyl-4-phenylazetidin-2-one (PubChem CID 155937095) has the molecular formula C23H20FNO3S and a molecular weight of 409.48 g/mol. Its IUPAC name is (3R)-1-benzyl-3-(4-fluorophenyl)sulfonyl-3-methyl-4-phenylazetidin-2-one.
| Compound Name | (3R)-1-benzyl-3-(4-fluorophenyl)sulfonyl-3-methyl-4-phenylazetidin-2-one |
|---|---|
| PubChem CID | 155937095 |
| Molecular Formula | C23H20FNO3S |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | (3R)-1-benzyl-3-(4-fluorophenyl)sulfonyl-3-methyl-4-phenylazetidin-2-one |
| SMILES | C[C@]1(S(=O)(=O)c2ccc(F)cc2)C(=O)N(Cc2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C23H20FNO3S/c1-23(29(27,28)20-14-12-19(24)13-15-20)21(18-10-6-3-7-11-18)25(22(23)26)16-17-8-4-2-5-9-17/h2-15,21H,16H2,1H3/t21?,23-/m1/s1 |
| InChIKey | QCXMAZQXCKRMKI-JFGZAKSSSA-N |
| XLogP | 4.14 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |