About methyl 5-[4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)amino]-2,5-dimethylphenoxy]-2,2-dimethylpentanoate
methyl 5-[4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)amino]-2,5-dimethylphenoxy]-2,2-dimethylpentanoate (PubChem CID 155937392) has the molecular formula C22H35NO5
and a molecular weight of 393.52 g/mol. Its IUPAC name is methyl 5-[4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)amino]-2,5-dimethylphenoxy]-2,2-dimethylpentanoate.
Molecular Properties
| Compound Name | methyl 5-[4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)amino]-2,5-dimethylphenoxy]-2,2-dimethylpentanoate |
| PubChem CID | 155937392 |
| Molecular Formula | C22H35NO5 |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | methyl 5-[4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)amino]-2,5-dimethylphenoxy]-2,2-dimethylpentanoate |
| SMILES | COC(=O)C(Nc1cc(C)c(OCCCC(C)(C)C(=O)OC)cc1C)C(C)C |
| InChI | InChI=1S/C22H35NO5/c1-14(2)19(20(24)26-7)23-17-12-16(4)18(13-15(17)3)28-11-9-10-22(5,6)21(25)27-8/h12-14,19,23H,9-11H2,1-8H3 |
| InChIKey | ICTDTXVAZDMYQR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-[4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)amino]-2,5-dimethylphenoxy]-2,2-dimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)amino]-2,5-dimethylphenoxy]-2,2-dimethylpentanoate?
The IUPAC name of methyl 5-[4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)amino]-2,5-dimethylphenoxy]-2,2-dimethylpentanoate (CID 155937392) is methyl 5-[4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)amino]-2,5-dimethylphenoxy]-2,2-dimethylpentanoate.
What is the SMILES notation for methyl 5-[4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)amino]-2,5-dimethylphenoxy]-2,2-dimethylpentanoate?
The canonical SMILES for methyl 5-[4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)amino]-2,5-dimethylphenoxy]-2,2-dimethylpentanoate is COC(=O)C(Nc1cc(C)c(OCCCC(C)(C)C(=O)OC)cc1C)C(C)C.
What is the InChIKey of methyl 5-[4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)amino]-2,5-dimethylphenoxy]-2,2-dimethylpentanoate?
The InChIKey is ICTDTXVAZDMYQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H35NO5/c1-14(2)19(20(24)26-7)23-17-12-16(4)18(13-15(17)3)28-11-9-10-22(5,6)21(25)27-8/h12-14,19,23H,9-11H2,1-8H3.
What are the key properties of methyl 5-[4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)amino]-2,5-dimethylphenoxy]-2,2-dimethylpentanoate?
methyl 5-[4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)amino]-2,5-dimethylphenoxy]-2,2-dimethylpentanoate has a molecular weight of 393.52 g/mol, XLogP of 4.27, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)amino]-2,5-dimethylphenoxy]-2,2-dimethylpentanoate is sourced from PubChem (CID 155937392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).