2-(6-chloropyrazin-2-yl)-2,2-difluoroacetic acid

C6H3ClF2N2O2 — CID 155937640

IUPAC2-(6-chloropyrazin-2-yl)-2,2-difluoroacetic acid
SMILESO=C(O)C(F)(F)c1cncc(Cl)n1
InChIInChI=1S/C6H3ClF2N2O2/c7-4-2-10-1-3(11-4)6(8,9)5(12)13/h1-2H,(H,12,13)
InChIKeyPGYGTMRZYGPEQR-UHFFFAOYSA-N
MW208.55 g/mol
LogP1.31
Rot. Bonds2

About 2-(6-chloropyrazin-2-yl)-2,2-difluoroacetic acid

2-(6-chloropyrazin-2-yl)-2,2-difluoroacetic acid (PubChem CID 155937640) has the molecular formula C6H3ClF2N2O2 and a molecular weight of 208.55 g/mol. Its IUPAC name is 2-(6-chloropyrazin-2-yl)-2,2-difluoroacetic acid.

Molecular Properties

Compound Name2-(6-chloropyrazin-2-yl)-2,2-difluoroacetic acid
PubChem CID155937640
Molecular FormulaC6H3ClF2N2O2
Molecular Weight208.55 g/mol
Exact Mass207.99
IUPAC Name2-(6-chloropyrazin-2-yl)-2,2-difluoroacetic acid
SMILESO=C(O)C(F)(F)c1cncc(Cl)n1
InChIInChI=1S/C6H3ClF2N2O2/c7-4-2-10-1-3(11-4)6(8,9)5(12)13/h1-2H,(H,12,13)
InChIKeyPGYGTMRZYGPEQR-UHFFFAOYSA-N
XLogP1.31
TPSA63.08 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.55
LogP ≤ 51.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(6-chloropyrazin-2-yl)-2,2-difluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(6-chloropyrazin-2-yl)-2,2-difluoroacetic acid?
The IUPAC name of 2-(6-chloropyrazin-2-yl)-2,2-difluoroacetic acid (CID 155937640) is 2-(6-chloropyrazin-2-yl)-2,2-difluoroacetic acid.
What is the SMILES notation for 2-(6-chloropyrazin-2-yl)-2,2-difluoroacetic acid?
The canonical SMILES for 2-(6-chloropyrazin-2-yl)-2,2-difluoroacetic acid is O=C(O)C(F)(F)c1cncc(Cl)n1.
What is the InChIKey of 2-(6-chloropyrazin-2-yl)-2,2-difluoroacetic acid?
The InChIKey is PGYGTMRZYGPEQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3ClF2N2O2/c7-4-2-10-1-3(11-4)6(8,9)5(12)13/h1-2H,(H,12,13).
What are the key properties of 2-(6-chloropyrazin-2-yl)-2,2-difluoroacetic acid?
2-(6-chloropyrazin-2-yl)-2,2-difluoroacetic acid has a molecular weight of 208.55 g/mol, XLogP of 1.31, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-chloropyrazin-2-yl)-2,2-difluoroacetic acid is sourced from PubChem (CID 155937640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).