C19H18N6O3 — CID 155937954
formic acid;5-methyl-3-phenyl-N-(2H-pyrazolo[3,4-b]pyridin-3-ylmethyl)-1H-pyrazole-4-carboxamide (PubChem CID 155937954) has the molecular formula C19H18N6O3 and a molecular weight of 378.39 g/mol. Its IUPAC name is formic acid;5-methyl-3-phenyl-N-(2H-pyrazolo[3,4-b]pyridin-3-ylmethyl)-1H-pyrazole-4-carboxamide.
| Compound Name | formic acid;5-methyl-3-phenyl-N-(2H-pyrazolo[3,4-b]pyridin-3-ylmethyl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 155937954 |
| Molecular Formula | C19H18N6O3 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | formic acid;5-methyl-3-phenyl-N-(2H-pyrazolo[3,4-b]pyridin-3-ylmethyl)-1H-pyrazole-4-carboxamide |
| SMILES | Cc1[nH]nc(-c2ccccc2)c1C(=O)NCc1[nH]nc2ncccc12.O=CO |
| InChI | InChI=1S/C18H16N6O.CH2O2/c1-11-15(16(23-21-11)12-6-3-2-4-7-12)18(25)20-10-14-13-8-5-9-19-17(13)24-22-14;2-1-3/h2-9H,10H2,1H3,(H,20,25)(H,21,23)(H,19,22,24);1H,(H,2,3) |
| InChIKey | PGZNTGHUAUDCPZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 136.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|