C13H20N6O5S — CID 155937994
formic acid;1-[(1R,2S,6R,7S)-10-methylsulfonyl-4,10-diazatricyclo[5.2.1.02,6]decan-4-yl]-2-(tetrazol-1-yl)ethanone (PubChem CID 155937994) has the molecular formula C13H20N6O5S and a molecular weight of 372.41 g/mol. Its IUPAC name is formic acid;1-[(1R,2S,6R,7S)-10-methylsulfonyl-4,10-diazatricyclo[5.2.1.02,6]decan-4-yl]-2-(tetrazol-1-yl)ethanone.
| Compound Name | formic acid;1-[(1R,2S,6R,7S)-10-methylsulfonyl-4,10-diazatricyclo[5.2.1.02,6]decan-4-yl]-2-(tetrazol-1-yl)ethanone |
|---|---|
| PubChem CID | 155937994 |
| Molecular Formula | C13H20N6O5S |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | formic acid;1-[(1R,2S,6R,7S)-10-methylsulfonyl-4,10-diazatricyclo[5.2.1.02,6]decan-4-yl]-2-(tetrazol-1-yl)ethanone |
| SMILES | CS(=O)(=O)N1[C@@H]2CC[C@H]1[C@H]1CN(C(=O)Cn3cnnn3)C[C@H]12.O=CO |
| InChI | InChI=1S/C12H18N6O3S.CH2O2/c1-22(20,21)18-10-2-3-11(18)9-5-16(4-8(9)10)12(19)6-17-7-13-14-15-17;2-1-3/h7-11H,2-6H2,1H3;1H,(H,2,3)/t8-,9+,10-,11+; |
| InChIKey | SXKVIUNQDKLYGH-NIQYDHDSSA-N |
| XLogP | -1.75 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|