C16H25ClN4O2 — CID 155937997
(1S,3R,4R)-3-amino-4-hydroxy-N-[(4-methyl-5,6,7,8-tetrahydroquinazolin-2-yl)methyl]cyclopentane-1-carboxamide;hydrochloride (PubChem CID 155937997) has the molecular formula C16H25ClN4O2 and a molecular weight of 340.86 g/mol. Its IUPAC name is (1S,3R,4R)-3-amino-4-hydroxy-N-[(4-methyl-5,6,7,8-tetrahydroquinazolin-2-yl)methyl]cyclopentane-1-carboxamide;hydrochloride.
| Compound Name | (1S,3R,4R)-3-amino-4-hydroxy-N-[(4-methyl-5,6,7,8-tetrahydroquinazolin-2-yl)methyl]cyclopentane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 155937997 |
| Molecular Formula | C16H25ClN4O2 |
| Molecular Weight | 340.86 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | (1S,3R,4R)-3-amino-4-hydroxy-N-[(4-methyl-5,6,7,8-tetrahydroquinazolin-2-yl)methyl]cyclopentane-1-carboxamide;hydrochloride |
| SMILES | Cc1nc(CNC(=O)[C@H]2C[C@@H](N)[C@H](O)C2)nc2c1CCCC2.Cl |
| InChI | InChI=1S/C16H24N4O2.ClH/c1-9-11-4-2-3-5-13(11)20-15(19-9)8-18-16(22)10-6-12(17)14(21)7-10;/h10,12,14,21H,2-8,17H2,1H3,(H,18,22);1H/t10-,12+,14+;/m0./s1 |
| InChIKey | OAKKJBTXVVIBNR-HVLTWFEBSA-N |
| XLogP | 0.80 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.86 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |