C18H26N6O7 — CID 155938692
3-[(2S,3S)-2-[(dimethylamino)methyl]-3-(1-methylpyrazol-4-yl)morpholine-4-carbonyl]-1H-pyrazin-2-one;formic acid (PubChem CID 155938692) has the molecular formula C18H26N6O7 and a molecular weight of 438.44 g/mol. Its IUPAC name is 3-[(2S,3S)-2-[(dimethylamino)methyl]-3-(1-methylpyrazol-4-yl)morpholine-4-carbonyl]-1H-pyrazin-2-one;formic acid.
| Compound Name | 3-[(2S,3S)-2-[(dimethylamino)methyl]-3-(1-methylpyrazol-4-yl)morpholine-4-carbonyl]-1H-pyrazin-2-one;formic acid |
|---|---|
| PubChem CID | 155938692 |
| Molecular Formula | C18H26N6O7 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 3-[(2S,3S)-2-[(dimethylamino)methyl]-3-(1-methylpyrazol-4-yl)morpholine-4-carbonyl]-1H-pyrazin-2-one;formic acid |
| SMILES | CN(C)C[C@@H]1OCCN(C(=O)c2ncc[nH]c2=O)[C@H]1c1cnn(C)c1.O=CO.O=CO |
| InChI | InChI=1S/C16H22N6O3.2CH2O2/c1-20(2)10-12-14(11-8-19-21(3)9-11)22(6-7-25-12)16(24)13-15(23)18-5-4-17-13;2*2-1-3/h4-5,8-9,12,14H,6-7,10H2,1-3H3,(H,18,23);2*1H,(H,2,3)/t12-,14-;;/m0../s1 |
| InChIKey | HUFYHWPTGICJRM-FORAGAHYSA-N |
| XLogP | -0.95 |
| TPSA | 170.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|