C22H30N4O4S — CID 155939331
formic acid;N-[[(1S,5S,6R,7R)-3-[2-(5-methylpyrazol-1-yl)ethyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-2-thiophen-3-ylacetamide (PubChem CID 155939331) has the molecular formula C22H30N4O4S and a molecular weight of 446.57 g/mol. Its IUPAC name is formic acid;N-[[(1S,5S,6R,7R)-3-[2-(5-methylpyrazol-1-yl)ethyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-2-thiophen-3-ylacetamide.
| Compound Name | formic acid;N-[[(1S,5S,6R,7R)-3-[2-(5-methylpyrazol-1-yl)ethyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-2-thiophen-3-ylacetamide |
|---|---|
| PubChem CID | 155939331 |
| Molecular Formula | C22H30N4O4S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | formic acid;N-[[(1S,5S,6R,7R)-3-[2-(5-methylpyrazol-1-yl)ethyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-2-thiophen-3-ylacetamide |
| SMILES | Cc1ccnn1CCN1C[C@@H]2[C@H](CNC(=O)Cc3ccsc3)[C@H]3CC[C@]2(C1)O3.O=CO |
| InChI | InChI=1S/C21H28N4O2S.CH2O2/c1-15-3-6-23-25(15)8-7-24-12-18-17(19-2-5-21(18,14-24)27-19)11-22-20(26)10-16-4-9-28-13-16;2-1-3/h3-4,6,9,13,17-19H,2,5,7-8,10-12,14H2,1H3,(H,22,26);1H,(H,2,3)/t17-,18+,19+,21+;/m0./s1 |
| InChIKey | VEVBGENLFKDZMC-BCFJUJROSA-N |
| XLogP | 1.79 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|