C21H40O4 — CID 15593943
bis(2,4,4-trimethylpentyl) pentanedioate (PubChem CID 15593943) has the molecular formula C21H40O4 and a molecular weight of 356.55 g/mol. Its IUPAC name is bis(2,4,4-trimethylpentyl) pentanedioate.
| Compound Name | bis(2,4,4-trimethylpentyl) pentanedioate |
|---|---|
| PubChem CID | 15593943 |
| Molecular Formula | C21H40O4 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.29 |
| IUPAC Name | bis(2,4,4-trimethylpentyl) pentanedioate |
| SMILES | CC(COC(=O)CCCC(=O)OCC(C)CC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C21H40O4/c1-16(12-20(3,4)5)14-24-18(22)10-9-11-19(23)25-15-17(2)13-21(6,7)8/h16-17H,9-15H2,1-8H3 |
| InChIKey | ARWFUUWYTHXGTH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |