C19H26F3N3O4 — CID 155939810
formic acid;11-(pyridin-2-ylmethyl)-3-(3,3,3-trifluoropropyl)-7-oxa-3,11-diazaspiro[5.6]dodecan-10-one (PubChem CID 155939810) has the molecular formula C19H26F3N3O4 and a molecular weight of 417.43 g/mol. Its IUPAC name is formic acid;11-(pyridin-2-ylmethyl)-3-(3,3,3-trifluoropropyl)-7-oxa-3,11-diazaspiro[5.6]dodecan-10-one.
| Compound Name | formic acid;11-(pyridin-2-ylmethyl)-3-(3,3,3-trifluoropropyl)-7-oxa-3,11-diazaspiro[5.6]dodecan-10-one |
|---|---|
| PubChem CID | 155939810 |
| Molecular Formula | C19H26F3N3O4 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | formic acid;11-(pyridin-2-ylmethyl)-3-(3,3,3-trifluoropropyl)-7-oxa-3,11-diazaspiro[5.6]dodecan-10-one |
| SMILES | O=C1CCOC2(CCN(CCC(F)(F)F)CC2)CN1Cc1ccccn1.O=CO |
| InChI | InChI=1S/C18H24F3N3O2.CH2O2/c19-18(20,21)7-11-23-9-5-17(6-10-23)14-24(16(25)4-12-26-17)13-15-3-1-2-8-22-15;2-1-3/h1-3,8H,4-7,9-14H2;1H,(H,2,3) |
| InChIKey | QSXFEBLMTSSPJJ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|