C15H25Cl2N3O2S — CID 155939948
(4aR,6S,8aR)-N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazine-6-carboxamide;dihydrochloride (PubChem CID 155939948) has the molecular formula C15H25Cl2N3O2S and a molecular weight of 382.36 g/mol. Its IUPAC name is (4aR,6S,8aR)-N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazine-6-carboxamide;dihydrochloride.
| Compound Name | (4aR,6S,8aR)-N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazine-6-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 155939948 |
| Molecular Formula | C15H25Cl2N3O2S |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | (4aR,6S,8aR)-N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazine-6-carboxamide;dihydrochloride |
| SMILES | Cc1nc(C)c(CNC(=O)[C@H]2CC[C@H]3OCCN[C@@H]3C2)s1.Cl.Cl |
| InChI | InChI=1S/C15H23N3O2S.2ClH/c1-9-14(21-10(2)18-9)8-17-15(19)11-3-4-13-12(7-11)16-5-6-20-13;;/h11-13,16H,3-8H2,1-2H3,(H,17,19);2*1H/t11-,12+,13+;;/m0../s1 |
| InChIKey | OZCGYRVDHPSIKD-QDDWCWDGSA-N |
| XLogP | 2.38 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |