C20H22N2O3S — CID 155940076
formic acid;2-(1H-indol-7-yl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine] (PubChem CID 155940076) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is formic acid;2-(1H-indol-7-yl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine].
| Compound Name | formic acid;2-(1H-indol-7-yl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine] |
|---|---|
| PubChem CID | 155940076 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | formic acid;2-(1H-indol-7-yl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine] |
| SMILES | O=CO.c1cc(-c2cc3c(s2)C2(CCNCC2)OCC3)c2[nH]ccc2c1 |
| InChI | InChI=1S/C19H20N2OS.CH2O2/c1-2-13-4-8-21-17(13)15(3-1)16-12-14-5-11-22-19(18(14)23-16)6-9-20-10-7-19;2-1-3/h1-4,8,12,20-21H,5-7,9-11H2;1H,(H,2,3) |
| InChIKey | FYIPIJYMQMDNHP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|