C21H25FN2O5 — CID 155940242
[(2S,3S)-2-[(dimethylamino)methyl]-3-phenylmorpholin-4-yl]-(4-fluoro-3-hydroxyphenyl)methanone;formic acid (PubChem CID 155940242) has the molecular formula C21H25FN2O5 and a molecular weight of 404.44 g/mol. Its IUPAC name is [(2S,3S)-2-[(dimethylamino)methyl]-3-phenylmorpholin-4-yl]-(4-fluoro-3-hydroxyphenyl)methanone;formic acid.
| Compound Name | [(2S,3S)-2-[(dimethylamino)methyl]-3-phenylmorpholin-4-yl]-(4-fluoro-3-hydroxyphenyl)methanone;formic acid |
|---|---|
| PubChem CID | 155940242 |
| Molecular Formula | C21H25FN2O5 |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | [(2S,3S)-2-[(dimethylamino)methyl]-3-phenylmorpholin-4-yl]-(4-fluoro-3-hydroxyphenyl)methanone;formic acid |
| SMILES | CN(C)C[C@@H]1OCCN(C(=O)c2ccc(F)c(O)c2)[C@H]1c1ccccc1.O=CO |
| InChI | InChI=1S/C20H23FN2O3.CH2O2/c1-22(2)13-18-19(14-6-4-3-5-7-14)23(10-11-26-18)20(25)15-8-9-16(21)17(24)12-15;2-1-3/h3-9,12,18-19,24H,10-11,13H2,1-2H3;1H,(H,2,3)/t18-,19-;/m0./s1 |
| InChIKey | RYKLEJNOHGXNDZ-HLRBRJAUSA-N |
| XLogP | 2.38 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|