C16H15FN2O2S — CID 155940306
[4-fluoro-3-(2-methyl-1,3-benzothiazol-5-yl)phenyl]methanamine;formic acid (PubChem CID 155940306) has the molecular formula C16H15FN2O2S and a molecular weight of 318.37 g/mol. Its IUPAC name is [4-fluoro-3-(2-methyl-1,3-benzothiazol-5-yl)phenyl]methanamine;formic acid.
| Compound Name | [4-fluoro-3-(2-methyl-1,3-benzothiazol-5-yl)phenyl]methanamine;formic acid |
|---|---|
| PubChem CID | 155940306 |
| Molecular Formula | C16H15FN2O2S |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | [4-fluoro-3-(2-methyl-1,3-benzothiazol-5-yl)phenyl]methanamine;formic acid |
| SMILES | Cc1nc2cc(-c3cc(CN)ccc3F)ccc2s1.O=CO |
| InChI | InChI=1S/C15H13FN2S.CH2O2/c1-9-18-14-7-11(3-5-15(14)19-9)12-6-10(8-17)2-4-13(12)16;2-1-3/h2-7H,8,17H2,1H3;1H,(H,2,3) |
| InChIKey | KYYUEKBELZSUOP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|