C19H27ClN4O4 — CID 155940455
2-[2-butyl-5-[(3-chlorophenoxy)methyl]-1,2,4-triazol-3-yl]-4-methylmorpholine;formic acid (PubChem CID 155940455) has the molecular formula C19H27ClN4O4 and a molecular weight of 410.90 g/mol. Its IUPAC name is 2-[2-butyl-5-[(3-chlorophenoxy)methyl]-1,2,4-triazol-3-yl]-4-methylmorpholine;formic acid.
| Compound Name | 2-[2-butyl-5-[(3-chlorophenoxy)methyl]-1,2,4-triazol-3-yl]-4-methylmorpholine;formic acid |
|---|---|
| PubChem CID | 155940455 |
| Molecular Formula | C19H27ClN4O4 |
| Molecular Weight | 410.90 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 2-[2-butyl-5-[(3-chlorophenoxy)methyl]-1,2,4-triazol-3-yl]-4-methylmorpholine;formic acid |
| SMILES | CCCCn1nc(COc2cccc(Cl)c2)nc1C1CN(C)CCO1.O=CO |
| InChI | InChI=1S/C18H25ClN4O2.CH2O2/c1-3-4-8-23-18(16-12-22(2)9-10-24-16)20-17(21-23)13-25-15-7-5-6-14(19)11-15;2-1-3/h5-7,11,16H,3-4,8-10,12-13H2,1-2H3;1H,(H,2,3) |
| InChIKey | GQEZYVULKWKLEE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.90 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|