C20H21N5O5 — CID 155940525
formic acid;3-[[2-(3,4,5-trimethoxyphenyl)imidazol-1-yl]methyl]imidazo[1,2-a]pyrazine (PubChem CID 155940525) has the molecular formula C20H21N5O5 and a molecular weight of 411.42 g/mol. Its IUPAC name is formic acid;3-[[2-(3,4,5-trimethoxyphenyl)imidazol-1-yl]methyl]imidazo[1,2-a]pyrazine.
| Compound Name | formic acid;3-[[2-(3,4,5-trimethoxyphenyl)imidazol-1-yl]methyl]imidazo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 155940525 |
| Molecular Formula | C20H21N5O5 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | formic acid;3-[[2-(3,4,5-trimethoxyphenyl)imidazol-1-yl]methyl]imidazo[1,2-a]pyrazine |
| SMILES | COc1cc(-c2nccn2Cc2cnc3cnccn23)cc(OC)c1OC.O=CO |
| InChI | InChI=1S/C19H19N5O3.CH2O2/c1-25-15-8-13(9-16(26-2)18(15)27-3)19-21-5-6-23(19)12-14-10-22-17-11-20-4-7-24(14)17;2-1-3/h4-11H,12H2,1-3H3;1H,(H,2,3) |
| InChIKey | MWMKNGDKOURYPL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 113.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|