C24H34N2O4 — CID 155940572
N-[[(1S,5S,6R,7R)-3-[(3,4-dimethylphenyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]cyclobutanecarboxamide;formic acid (PubChem CID 155940572) has the molecular formula C24H34N2O4 and a molecular weight of 414.55 g/mol. Its IUPAC name is N-[[(1S,5S,6R,7R)-3-[(3,4-dimethylphenyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]cyclobutanecarboxamide;formic acid.
| Compound Name | N-[[(1S,5S,6R,7R)-3-[(3,4-dimethylphenyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]cyclobutanecarboxamide;formic acid |
|---|---|
| PubChem CID | 155940572 |
| Molecular Formula | C24H34N2O4 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | N-[[(1S,5S,6R,7R)-3-[(3,4-dimethylphenyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]cyclobutanecarboxamide;formic acid |
| SMILES | Cc1ccc(CN2C[C@@H]3[C@H](CNC(=O)C4CCC4)[C@H]4CC[C@]3(C2)O4)cc1C.O=CO |
| InChI | InChI=1S/C23H32N2O2.CH2O2/c1-15-6-7-17(10-16(15)2)12-25-13-20-19(11-24-22(26)18-4-3-5-18)21-8-9-23(20,14-25)27-21;2-1-3/h6-7,10,18-21H,3-5,8-9,11-14H2,1-2H3,(H,24,26);1H,(H,2,3)/t19-,20+,21+,23+;/m0./s1 |
| InChIKey | UTQVYBAGWYMTPW-PRDIJZEFSA-N |
| XLogP | 2.90 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|