C16H26FN5O5 — CID 155940737
2-N-[(3S,7S,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-5-fluoro-4-N,4-N-dimethylpyrimidine-2,4-diamine;formic acid (PubChem CID 155940737) has the molecular formula C16H26FN5O5 and a molecular weight of 387.41 g/mol. Its IUPAC name is 2-N-[(3S,7S,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-5-fluoro-4-N,4-N-dimethylpyrimidine-2,4-diamine;formic acid.
| Compound Name | 2-N-[(3S,7S,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-5-fluoro-4-N,4-N-dimethylpyrimidine-2,4-diamine;formic acid |
|---|---|
| PubChem CID | 155940737 |
| Molecular Formula | C16H26FN5O5 |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 2-N-[(3S,7S,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-5-fluoro-4-N,4-N-dimethylpyrimidine-2,4-diamine;formic acid |
| SMILES | C[C@H]1CN2C[C@@H](Nc3ncc(F)c(N(C)C)n3)C[C@H]2CO1.O=CO.O=CO |
| InChI | InChI=1S/C14H22FN5O.2CH2O2/c1-9-6-20-7-10(4-11(20)8-21-9)17-14-16-5-12(15)13(18-14)19(2)3;2*2-1-3/h5,9-11H,4,6-8H2,1-3H3,(H,16,17,18);2*1H,(H,2,3)/t9-,10-,11-;;/m0../s1 |
| InChIKey | WSMGYTNTMGDTST-MTGXZCMWSA-N |
| XLogP | 0.36 |
| TPSA | 128.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|