C17H22ClF3N4O — CID 155940957
(1S,2S,4S)-2-methoxy-4-[5-phenyl-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]cyclohexan-1-amine;hydrochloride (PubChem CID 155940957) has the molecular formula C17H22ClF3N4O and a molecular weight of 390.84 g/mol. Its IUPAC name is (1S,2S,4S)-2-methoxy-4-[5-phenyl-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]cyclohexan-1-amine;hydrochloride.
| Compound Name | (1S,2S,4S)-2-methoxy-4-[5-phenyl-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]cyclohexan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 155940957 |
| Molecular Formula | C17H22ClF3N4O |
| Molecular Weight | 390.84 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | (1S,2S,4S)-2-methoxy-4-[5-phenyl-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]cyclohexan-1-amine;hydrochloride |
| SMILES | CO[C@H]1C[C@@H](c2nc(-c3ccccc3)nn2CC(F)(F)F)CC[C@@H]1N.Cl |
| InChI | InChI=1S/C17H21F3N4O.ClH/c1-25-14-9-12(7-8-13(14)21)16-22-15(11-5-3-2-4-6-11)23-24(16)10-17(18,19)20;/h2-6,12-14H,7-10,21H2,1H3;1H/t12-,13-,14-;/m0./s1 |
| InChIKey | WHAALQGYYGDOBC-JKBZPBJLSA-N |
| XLogP | 3.54 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.84 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |