C14H20Cl2F3N7O — CID 155941177
N-methyl-2-[5-(6,7,8,9-tetrahydro-5H-imidazo[1,2-d][1,4]diazepin-2-yl)-1-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]acetamide;dihydrochloride (PubChem CID 155941177) has the molecular formula C14H20Cl2F3N7O and a molecular weight of 430.26 g/mol. Its IUPAC name is N-methyl-2-[5-(6,7,8,9-tetrahydro-5H-imidazo[1,2-d][1,4]diazepin-2-yl)-1-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]acetamide;dihydrochloride.
| Compound Name | N-methyl-2-[5-(6,7,8,9-tetrahydro-5H-imidazo[1,2-d][1,4]diazepin-2-yl)-1-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 155941177 |
| Molecular Formula | C14H20Cl2F3N7O |
| Molecular Weight | 430.26 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | N-methyl-2-[5-(6,7,8,9-tetrahydro-5H-imidazo[1,2-d][1,4]diazepin-2-yl)-1-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]acetamide;dihydrochloride |
| SMILES | CNC(=O)Cc1nc(-c2cn3c(n2)CCNCC3)n(CC(F)(F)F)n1.Cl.Cl |
| InChI | InChI=1S/C14H18F3N7O.2ClH/c1-18-12(25)6-10-21-13(24(22-10)8-14(15,16)17)9-7-23-5-4-19-3-2-11(23)20-9;;/h7,19H,2-6,8H2,1H3,(H,18,25);2*1H |
| InChIKey | MNLLGNWAPWFCLY-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 89.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.26 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |