C18H20ClFN4O2 — CID 155941561
1-[4-[(5-chloropyrimidin-2-yl)-methylamino]piperidin-1-yl]-2-(4-fluorophenoxy)ethanone (PubChem CID 155941561) has the molecular formula C18H20ClFN4O2 and a molecular weight of 378.84 g/mol. Its IUPAC name is 1-[4-[(5-chloropyrimidin-2-yl)-methylamino]piperidin-1-yl]-2-(4-fluorophenoxy)ethanone.
| Compound Name | 1-[4-[(5-chloropyrimidin-2-yl)-methylamino]piperidin-1-yl]-2-(4-fluorophenoxy)ethanone |
|---|---|
| PubChem CID | 155941561 |
| Molecular Formula | C18H20ClFN4O2 |
| Molecular Weight | 378.84 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 1-[4-[(5-chloropyrimidin-2-yl)-methylamino]piperidin-1-yl]-2-(4-fluorophenoxy)ethanone |
| SMILES | CN(c1ncc(Cl)cn1)C1CCN(C(=O)COc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H20ClFN4O2/c1-23(18-21-10-13(19)11-22-18)15-6-8-24(9-7-15)17(25)12-26-16-4-2-14(20)3-5-16/h2-5,10-11,15H,6-9,12H2,1H3 |
| InChIKey | SQOLKAUYFZGTFP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.84 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |