About 1-(2,5-dimethyl-1,3-oxazol-4-yl)ethanamine;hydrochloride
1-(2,5-dimethyl-1,3-oxazol-4-yl)ethanamine;hydrochloride (PubChem CID 155943307) has the molecular formula C7H13ClN2O
and a molecular weight of 176.65 g/mol. Its IUPAC name is 1-(2,5-dimethyl-1,3-oxazol-4-yl)ethanamine;hydrochloride.
Molecular Properties
| Compound Name | 1-(2,5-dimethyl-1,3-oxazol-4-yl)ethanamine;hydrochloride |
| PubChem CID | 155943307 |
| Molecular Formula | C7H13ClN2O |
| Molecular Weight | 176.65 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 1-(2,5-dimethyl-1,3-oxazol-4-yl)ethanamine;hydrochloride |
| SMILES | Cc1nc(C(C)N)c(C)o1.Cl |
| InChI | InChI=1S/C7H12N2O.ClH/c1-4(8)7-5(2)10-6(3)9-7;/h4H,8H2,1-3H3;1H |
| InChIKey | QOSWPDQOBQZPLI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.65 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2,5-dimethyl-1,3-oxazol-4-yl)ethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,5-dimethyl-1,3-oxazol-4-yl)ethanamine;hydrochloride?
The IUPAC name of 1-(2,5-dimethyl-1,3-oxazol-4-yl)ethanamine;hydrochloride (CID 155943307) is 1-(2,5-dimethyl-1,3-oxazol-4-yl)ethanamine;hydrochloride.
What is the SMILES notation for 1-(2,5-dimethyl-1,3-oxazol-4-yl)ethanamine;hydrochloride?
The canonical SMILES for 1-(2,5-dimethyl-1,3-oxazol-4-yl)ethanamine;hydrochloride is Cc1nc(C(C)N)c(C)o1.Cl.
What is the InChIKey of 1-(2,5-dimethyl-1,3-oxazol-4-yl)ethanamine;hydrochloride?
The InChIKey is QOSWPDQOBQZPLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O.ClH/c1-4(8)7-5(2)10-6(3)9-7;/h4H,8H2,1-3H3;1H.
What are the key properties of 1-(2,5-dimethyl-1,3-oxazol-4-yl)ethanamine;hydrochloride?
1-(2,5-dimethyl-1,3-oxazol-4-yl)ethanamine;hydrochloride has a molecular weight of 176.65 g/mol, XLogP of 1.73, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,5-dimethyl-1,3-oxazol-4-yl)ethanamine;hydrochloride is sourced from PubChem (CID 155943307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).