C10H14ClNO — CID 155943544
3-methoxy-1,2,3,4-tetrahydroquinoline;hydrochloride (PubChem CID 155943544) has the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. Its IUPAC name is 3-methoxy-1,2,3,4-tetrahydroquinoline;hydrochloride.
| Compound Name | 3-methoxy-1,2,3,4-tetrahydroquinoline;hydrochloride |
|---|---|
| PubChem CID | 155943544 |
| Molecular Formula | C10H14ClNO |
| Molecular Weight | 199.68 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 3-methoxy-1,2,3,4-tetrahydroquinoline;hydrochloride |
| SMILES | COC1CNc2ccccc2C1.Cl |
| InChI | InChI=1S/C10H13NO.ClH/c1-12-9-6-8-4-2-3-5-10(8)11-7-9;/h2-5,9,11H,6-7H2,1H3;1H |
| InChIKey | PULJPYFTYQSEGX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.68 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |