About lithium 5-ethyl-1,3-oxazole-2-carboxylate
lithium 5-ethyl-1,3-oxazole-2-carboxylate (PubChem CID 155943585) has the molecular formula C6H6LiNO3
and a molecular weight of 147.06 g/mol. Its IUPAC name is lithium 5-ethyl-1,3-oxazole-2-carboxylate.
Molecular Properties
| Compound Name | lithium 5-ethyl-1,3-oxazole-2-carboxylate |
| PubChem CID | 155943585 |
| Molecular Formula | C6H6LiNO3 |
| Molecular Weight | 147.06 g/mol |
| Exact Mass | 147.05 |
| IUPAC Name | lithium 5-ethyl-1,3-oxazole-2-carboxylate |
| SMILES | CCc1cnc(C(=O)[O-])o1.[Li+] |
| InChI | InChI=1S/C6H7NO3.Li/c1-2-4-3-7-5(10-4)6(8)9;/h3H,2H2,1H3,(H,8,9);/q;+1/p-1 |
| InChIKey | QLHHETLFDQVRSV-UHFFFAOYSA-M |
| XLogP | -3.40 |
| TPSA | 66.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.06 |
| LogP ≤ 5 | -3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze lithium 5-ethyl-1,3-oxazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 5-ethyl-1,3-oxazole-2-carboxylate?
The IUPAC name of lithium 5-ethyl-1,3-oxazole-2-carboxylate (CID 155943585) is lithium 5-ethyl-1,3-oxazole-2-carboxylate.
What is the SMILES notation for lithium 5-ethyl-1,3-oxazole-2-carboxylate?
The canonical SMILES for lithium 5-ethyl-1,3-oxazole-2-carboxylate is CCc1cnc(C(=O)[O-])o1.[Li+].
What is the InChIKey of lithium 5-ethyl-1,3-oxazole-2-carboxylate?
The InChIKey is QLHHETLFDQVRSV-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H7NO3.Li/c1-2-4-3-7-5(10-4)6(8)9;/h3H,2H2,1H3,(H,8,9);/q;+1/p-1.
What are the key properties of lithium 5-ethyl-1,3-oxazole-2-carboxylate?
lithium 5-ethyl-1,3-oxazole-2-carboxylate has a molecular weight of 147.06 g/mol, XLogP of -3.40, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 5-ethyl-1,3-oxazole-2-carboxylate is sourced from PubChem (CID 155943585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).