About [4-(3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]methanol;hydrochloride
[4-(3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]methanol;hydrochloride (PubChem CID 155943671) has the molecular formula C12H14ClFN2O
and a molecular weight of 256.71 g/mol. Its IUPAC name is [4-(3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]methanol;hydrochloride.
Molecular Properties
| Compound Name | [4-(3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]methanol;hydrochloride |
| PubChem CID | 155943671 |
| Molecular Formula | C12H14ClFN2O |
| Molecular Weight | 256.71 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | [4-(3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]methanol;hydrochloride |
| SMILES | Cc1cc(C)n(-c2ccc(CO)cc2F)n1.Cl |
| InChI | InChI=1S/C12H13FN2O.ClH/c1-8-5-9(2)15(14-8)12-4-3-10(7-16)6-11(12)13;/h3-6,16H,7H2,1-2H3;1H |
| InChIKey | FMNKZFBWDQKQNA-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.71 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-(3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]methanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]methanol;hydrochloride?
The IUPAC name of [4-(3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]methanol;hydrochloride (CID 155943671) is [4-(3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]methanol;hydrochloride.
What is the SMILES notation for [4-(3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]methanol;hydrochloride?
The canonical SMILES for [4-(3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]methanol;hydrochloride is Cc1cc(C)n(-c2ccc(CO)cc2F)n1.Cl.
What is the InChIKey of [4-(3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]methanol;hydrochloride?
The InChIKey is FMNKZFBWDQKQNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13FN2O.ClH/c1-8-5-9(2)15(14-8)12-4-3-10(7-16)6-11(12)13;/h3-6,16H,7H2,1-2H3;1H.
What are the key properties of [4-(3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]methanol;hydrochloride?
[4-(3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]methanol;hydrochloride has a molecular weight of 256.71 g/mol, XLogP of 2.54, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]methanol;hydrochloride is sourced from PubChem (CID 155943671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).