About 2-[(1S,2R)-2-(trifluoromethyl)cyclobutyl]acetic acid
2-[(1S,2R)-2-(trifluoromethyl)cyclobutyl]acetic acid (PubChem CID 155943722) has the molecular formula C7H9F3O2
and a molecular weight of 182.14 g/mol. Its IUPAC name is 2-[(1S,2R)-2-(trifluoromethyl)cyclobutyl]acetic acid.
Molecular Properties
| Compound Name | 2-[(1S,2R)-2-(trifluoromethyl)cyclobutyl]acetic acid |
| PubChem CID | 155943722 |
| Molecular Formula | C7H9F3O2 |
| Molecular Weight | 182.14 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 2-[(1S,2R)-2-(trifluoromethyl)cyclobutyl]acetic acid |
| SMILES | O=C(O)C[C@@H]1CC[C@H]1C(F)(F)F |
| InChI | InChI=1S/C7H9F3O2/c8-7(9,10)5-2-1-4(5)3-6(11)12/h4-5H,1-3H2,(H,11,12)/t4-,5+/m0/s1 |
| InChIKey | XOKQDXCIBUJFBV-CRCLSJGQSA-N |
| XLogP | 2.05 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.14 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[(1S,2R)-2-(trifluoromethyl)cyclobutyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S,2R)-2-(trifluoromethyl)cyclobutyl]acetic acid?
The IUPAC name of 2-[(1S,2R)-2-(trifluoromethyl)cyclobutyl]acetic acid (CID 155943722) is 2-[(1S,2R)-2-(trifluoromethyl)cyclobutyl]acetic acid.
What is the SMILES notation for 2-[(1S,2R)-2-(trifluoromethyl)cyclobutyl]acetic acid?
The canonical SMILES for 2-[(1S,2R)-2-(trifluoromethyl)cyclobutyl]acetic acid is O=C(O)C[C@@H]1CC[C@H]1C(F)(F)F.
What is the InChIKey of 2-[(1S,2R)-2-(trifluoromethyl)cyclobutyl]acetic acid?
The InChIKey is XOKQDXCIBUJFBV-CRCLSJGQSA-N. The full InChI is InChI=1S/C7H9F3O2/c8-7(9,10)5-2-1-4(5)3-6(11)12/h4-5H,1-3H2,(H,11,12)/t4-,5+/m0/s1.
What are the key properties of 2-[(1S,2R)-2-(trifluoromethyl)cyclobutyl]acetic acid?
2-[(1S,2R)-2-(trifluoromethyl)cyclobutyl]acetic acid has a molecular weight of 182.14 g/mol, XLogP of 2.05, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S,2R)-2-(trifluoromethyl)cyclobutyl]acetic acid is sourced from PubChem (CID 155943722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).