C9H19F2NO — CID 155943803
5-amino-4,4-difluoro-2,2,5-trimethylhexan-3-ol (PubChem CID 155943803) has the molecular formula C9H19F2NO and a molecular weight of 195.25 g/mol. Its IUPAC name is 5-amino-4,4-difluoro-2,2,5-trimethylhexan-3-ol.
| Compound Name | 5-amino-4,4-difluoro-2,2,5-trimethylhexan-3-ol |
|---|---|
| PubChem CID | 155943803 |
| Molecular Formula | C9H19F2NO |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 5-amino-4,4-difluoro-2,2,5-trimethylhexan-3-ol |
| SMILES | CC(C)(C)C(O)C(F)(F)C(C)(C)N |
| InChI | InChI=1S/C9H19F2NO/c1-7(2,3)6(13)9(10,11)8(4,5)12/h6,13H,12H2,1-5H3 |
| InChIKey | CAGQBTKNIXKEHW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |