C15H22N2OS2 — CID 155944930
1-(3,4-dihydro-1H-isothiochromen-1-ylmethyl)-3-(3-methylsulfanylpropyl)urea (PubChem CID 155944930) has the molecular formula C15H22N2OS2 and a molecular weight of 310.49 g/mol. Its IUPAC name is 1-(3,4-dihydro-1H-isothiochromen-1-ylmethyl)-3-(3-methylsulfanylpropyl)urea.
| Compound Name | 1-(3,4-dihydro-1H-isothiochromen-1-ylmethyl)-3-(3-methylsulfanylpropyl)urea |
|---|---|
| PubChem CID | 155944930 |
| Molecular Formula | C15H22N2OS2 |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 1-(3,4-dihydro-1H-isothiochromen-1-ylmethyl)-3-(3-methylsulfanylpropyl)urea |
| SMILES | CSCCCNC(=O)NCC1SCCc2ccccc21 |
| InChI | InChI=1S/C15H22N2OS2/c1-19-9-4-8-16-15(18)17-11-14-13-6-3-2-5-12(13)7-10-20-14/h2-3,5-6,14H,4,7-11H2,1H3,(H2,16,17,18) |
| InChIKey | BCTWPJFQIWMAMI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|