C21H20FN5O4S — CID 155945445
(1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazin-3-yl)-[3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]methanone (PubChem CID 155945445) has the molecular formula C21H20FN5O4S and a molecular weight of 457.49 g/mol. Its IUPAC name is (1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazin-3-yl)-[3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]methanone.
| Compound Name | (1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazin-3-yl)-[3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 155945445 |
| Molecular Formula | C21H20FN5O4S |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | (1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazin-3-yl)-[3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]methanone |
| SMILES | O=C(C1Nc2ccccc2S(=O)(=O)N1)N1CCCC(c2nc(-c3ccc(F)cc3)no2)C1 |
| InChI | InChI=1S/C21H20FN5O4S/c22-15-9-7-13(8-10-15)18-24-20(31-25-18)14-4-3-11-27(12-14)21(28)19-23-16-5-1-2-6-17(16)32(29,30)26-19/h1-2,5-10,14,19,23,26H,3-4,11-12H2 |
| InChIKey | KFVZTTUELXKQIS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 117.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |