C17H17N3O3S — CID 155946342
N-[3-(1,3-dioxoisoindol-2-yl)propyl]-2-ethyl-1,3-thiazole-5-carboxamide (PubChem CID 155946342) has the molecular formula C17H17N3O3S and a molecular weight of 343.41 g/mol. Its IUPAC name is N-[3-(1,3-dioxoisoindol-2-yl)propyl]-2-ethyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[3-(1,3-dioxoisoindol-2-yl)propyl]-2-ethyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 155946342 |
| Molecular Formula | C17H17N3O3S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | N-[3-(1,3-dioxoisoindol-2-yl)propyl]-2-ethyl-1,3-thiazole-5-carboxamide |
| SMILES | CCc1ncc(C(=O)NCCCN2C(=O)c3ccccc3C2=O)s1 |
| InChI | InChI=1S/C17H17N3O3S/c1-2-14-19-10-13(24-14)15(21)18-8-5-9-20-16(22)11-6-3-4-7-12(11)17(20)23/h3-4,6-7,10H,2,5,8-9H2,1H3,(H,18,21) |
| InChIKey | WCBOAIJMELBRET-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|