C6H13NO2 — CID 15594658
(3S,5S)-5-(hydroxymethyl)-1-methylpyrrolidin-3-ol (PubChem CID 15594658) has the molecular formula C6H13NO2 and a molecular weight of 131.17 g/mol. Its IUPAC name is (3S,5S)-5-(hydroxymethyl)-1-methylpyrrolidin-3-ol.
| Compound Name | (3S,5S)-5-(hydroxymethyl)-1-methylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 15594658 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.17 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | (3S,5S)-5-(hydroxymethyl)-1-methylpyrrolidin-3-ol |
| SMILES | CN1C[C@H](C[C@H]1CO)O |
| InChI | InChI=1S/C6H13NO2/c1-7-3-6(9)2-5(7)4-8/h5-6,8-9H,2-4H2,1H3/t5-,6-/m0/s1 |
| InChIKey | IXFHJDFJPFHQLP-WDSKDSINSA-N |
| XLogP | -0.80 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | 97 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.17 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |