About (3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-(2-hydroxyethyl)pyrrolidin-2-one
(3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-(2-hydroxyethyl)pyrrolidin-2-one (PubChem CID 15594666) has the molecular formula C21H31NO3
and a molecular weight of 345.48 g/mol. Its IUPAC name is (3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-(2-hydroxyethyl)pyrrolidin-2-one.
Molecular Properties
| Compound Name | (3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-(2-hydroxyethyl)pyrrolidin-2-one |
| PubChem CID | 15594666 |
| Molecular Formula | C21H31NO3 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | (3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-(2-hydroxyethyl)pyrrolidin-2-one |
| SMILES | CC(C)(C)c1cc(/C=C2\CCN(CCO)C2=O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C21H31NO3/c1-20(2,3)16-12-14(13-17(18(16)24)21(4,5)6)11-15-7-8-22(9-10-23)19(15)25/h11-13,23-24H,7-10H2,1-6H3/b15-11+ |
| InChIKey | VLZAWALSZLBIIH-RVDMUPIBSA-N |
| XLogP | 3.60 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-(2-hydroxyethyl)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-(2-hydroxyethyl)pyrrolidin-2-one?
The IUPAC name of (3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-(2-hydroxyethyl)pyrrolidin-2-one (CID 15594666) is (3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-(2-hydroxyethyl)pyrrolidin-2-one.
What is the SMILES notation for (3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-(2-hydroxyethyl)pyrrolidin-2-one?
The canonical SMILES for (3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-(2-hydroxyethyl)pyrrolidin-2-one is CC(C)(C)c1cc(/C=C2\CCN(CCO)C2=O)cc(C(C)(C)C)c1O.
What is the InChIKey of (3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-(2-hydroxyethyl)pyrrolidin-2-one?
The InChIKey is VLZAWALSZLBIIH-RVDMUPIBSA-N. The full InChI is InChI=1S/C21H31NO3/c1-20(2,3)16-12-14(13-17(18(16)24)21(4,5)6)11-15-7-8-22(9-10-23)19(15)25/h11-13,23-24H,7-10H2,1-6H3/b15-11+.
What are the key properties of (3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-(2-hydroxyethyl)pyrrolidin-2-one?
(3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-(2-hydroxyethyl)pyrrolidin-2-one has a molecular weight of 345.48 g/mol, XLogP of 3.60, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-(2-hydroxyethyl)pyrrolidin-2-one is sourced from PubChem (CID 15594666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).