C22H20FN3O3 — CID 155947041
N-[[4-(carbamoylamino)phenyl]methyl]-2-[(4-fluorophenyl)methoxy]benzamide (PubChem CID 155947041) has the molecular formula C22H20FN3O3 and a molecular weight of 393.42 g/mol. Its IUPAC name is N-[[4-(carbamoylamino)phenyl]methyl]-2-[(4-fluorophenyl)methoxy]benzamide.
| Compound Name | N-[[4-(carbamoylamino)phenyl]methyl]-2-[(4-fluorophenyl)methoxy]benzamide |
|---|---|
| PubChem CID | 155947041 |
| Molecular Formula | C22H20FN3O3 |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | N-[[4-(carbamoylamino)phenyl]methyl]-2-[(4-fluorophenyl)methoxy]benzamide |
| SMILES | NC(=O)Nc1ccc(CNC(=O)c2ccccc2OCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C22H20FN3O3/c23-17-9-5-16(6-10-17)14-29-20-4-2-1-3-19(20)21(27)25-13-15-7-11-18(12-8-15)26-22(24)28/h1-12H,13-14H2,(H,25,27)(H3,24,26,28) |
| InChIKey | LEFBFHQGBHLVMB-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |