C16H19N3O2 — CID 155949082
N-[(2-methoxyquinolin-4-yl)methyl]pyrrolidine-1-carboxamide (PubChem CID 155949082) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is N-[(2-methoxyquinolin-4-yl)methyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[(2-methoxyquinolin-4-yl)methyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 155949082 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | N-[(2-methoxyquinolin-4-yl)methyl]pyrrolidine-1-carboxamide |
| SMILES | COc1cc(CNC(=O)N2CCCC2)c2ccccc2n1 |
| InChI | InChI=1S/C16H19N3O2/c1-21-15-10-12(13-6-2-3-7-14(13)18-15)11-17-16(20)19-8-4-5-9-19/h2-3,6-7,10H,4-5,8-9,11H2,1H3,(H,17,20) |
| InChIKey | FOLSYXLIGXSFRC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |