About 2,3-dihydro-1,4-benzoxathiin-2-ylmethyl 4-phenoxypyridine-2-carboxylate
2,3-dihydro-1,4-benzoxathiin-2-ylmethyl 4-phenoxypyridine-2-carboxylate (PubChem CID 155949120) has the molecular formula C21H17NO4S
and a molecular weight of 379.44 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzoxathiin-2-ylmethyl 4-phenoxypyridine-2-carboxylate.
Molecular Properties
| Compound Name | 2,3-dihydro-1,4-benzoxathiin-2-ylmethyl 4-phenoxypyridine-2-carboxylate |
| PubChem CID | 155949120 |
| Molecular Formula | C21H17NO4S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 2,3-dihydro-1,4-benzoxathiin-2-ylmethyl 4-phenoxypyridine-2-carboxylate |
| SMILES | O=C(OCC1CSc2ccccc2O1)c1cc(Oc2ccccc2)ccn1 |
| InChI | InChI=1S/C21H17NO4S/c23-21(24-13-17-14-27-20-9-5-4-8-19(20)26-17)18-12-16(10-11-22-18)25-15-6-2-1-3-7-15/h1-12,17H,13-14H2 |
| InChIKey | KJVNZELFHLDSJW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2,3-dihydro-1,4-benzoxathiin-2-ylmethyl 4-phenoxypyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1,4-benzoxathiin-2-ylmethyl 4-phenoxypyridine-2-carboxylate?
The IUPAC name of 2,3-dihydro-1,4-benzoxathiin-2-ylmethyl 4-phenoxypyridine-2-carboxylate (CID 155949120) is 2,3-dihydro-1,4-benzoxathiin-2-ylmethyl 4-phenoxypyridine-2-carboxylate.
What is the SMILES notation for 2,3-dihydro-1,4-benzoxathiin-2-ylmethyl 4-phenoxypyridine-2-carboxylate?
The canonical SMILES for 2,3-dihydro-1,4-benzoxathiin-2-ylmethyl 4-phenoxypyridine-2-carboxylate is O=C(OCC1CSc2ccccc2O1)c1cc(Oc2ccccc2)ccn1.
What is the InChIKey of 2,3-dihydro-1,4-benzoxathiin-2-ylmethyl 4-phenoxypyridine-2-carboxylate?
The InChIKey is KJVNZELFHLDSJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17NO4S/c23-21(24-13-17-14-27-20-9-5-4-8-19(20)26-17)18-12-16(10-11-22-18)25-15-6-2-1-3-7-15/h1-12,17H,13-14H2.
What are the key properties of 2,3-dihydro-1,4-benzoxathiin-2-ylmethyl 4-phenoxypyridine-2-carboxylate?
2,3-dihydro-1,4-benzoxathiin-2-ylmethyl 4-phenoxypyridine-2-carboxylate has a molecular weight of 379.44 g/mol, XLogP of 4.58, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1,4-benzoxathiin-2-ylmethyl 4-phenoxypyridine-2-carboxylate is sourced from PubChem (CID 155949120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).