About ethyl 2-[[(2S,4S)-4-hydroxy-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-1,3-thiazole-4-carboxylate
ethyl 2-[[(2S,4S)-4-hydroxy-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-1,3-thiazole-4-carboxylate (PubChem CID 155950634) has the molecular formula C12H18N2O4S
and a molecular weight of 286.35 g/mol. Its IUPAC name is ethyl 2-[[(2S,4S)-4-hydroxy-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-[[(2S,4S)-4-hydroxy-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-1,3-thiazole-4-carboxylate |
| PubChem CID | 155950634 |
| Molecular Formula | C12H18N2O4S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | ethyl 2-[[(2S,4S)-4-hydroxy-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(CN2C[C@@H](O)C[C@H]2CO)n1 |
| InChI | InChI=1S/C12H18N2O4S/c1-2-18-12(17)10-7-19-11(13-10)5-14-4-9(16)3-8(14)6-15/h7-9,15-16H,2-6H2,1H3/t8-,9-/m0/s1 |
| InChIKey | FYYQSMQDYJOGCX-IUCAKERBSA-N |
| XLogP | 0.25 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 2-[[(2S,4S)-4-hydroxy-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[[(2S,4S)-4-hydroxy-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-1,3-thiazole-4-carboxylate?
The IUPAC name of ethyl 2-[[(2S,4S)-4-hydroxy-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-1,3-thiazole-4-carboxylate (CID 155950634) is ethyl 2-[[(2S,4S)-4-hydroxy-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-1,3-thiazole-4-carboxylate.
What is the SMILES notation for ethyl 2-[[(2S,4S)-4-hydroxy-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-1,3-thiazole-4-carboxylate?
The canonical SMILES for ethyl 2-[[(2S,4S)-4-hydroxy-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-1,3-thiazole-4-carboxylate is CCOC(=O)c1csc(CN2C[C@@H](O)C[C@H]2CO)n1.
What is the InChIKey of ethyl 2-[[(2S,4S)-4-hydroxy-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-1,3-thiazole-4-carboxylate?
The InChIKey is FYYQSMQDYJOGCX-IUCAKERBSA-N. The full InChI is InChI=1S/C12H18N2O4S/c1-2-18-12(17)10-7-19-11(13-10)5-14-4-9(16)3-8(14)6-15/h7-9,15-16H,2-6H2,1H3/t8-,9-/m0/s1.
What are the key properties of ethyl 2-[[(2S,4S)-4-hydroxy-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-1,3-thiazole-4-carboxylate?
ethyl 2-[[(2S,4S)-4-hydroxy-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-1,3-thiazole-4-carboxylate has a molecular weight of 286.35 g/mol, XLogP of 0.25, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[[(2S,4S)-4-hydroxy-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 155950634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).