C17H14FN3O2 — CID 155951016
2-[3-(2-fluorophenyl)-2,5-dihydropyrrol-1-yl]-2-oxo-N-pyridin-3-ylacetamide (PubChem CID 155951016) has the molecular formula C17H14FN3O2 and a molecular weight of 311.32 g/mol. Its IUPAC name is 2-[3-(2-fluorophenyl)-2,5-dihydropyrrol-1-yl]-2-oxo-N-pyridin-3-ylacetamide.
| Compound Name | 2-[3-(2-fluorophenyl)-2,5-dihydropyrrol-1-yl]-2-oxo-N-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 155951016 |
| Molecular Formula | C17H14FN3O2 |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 2-[3-(2-fluorophenyl)-2,5-dihydropyrrol-1-yl]-2-oxo-N-pyridin-3-ylacetamide |
| SMILES | O=C(Nc1cccnc1)C(=O)N1CC=C(c2ccccc2F)C1 |
| InChI | InChI=1S/C17H14FN3O2/c18-15-6-2-1-5-14(15)12-7-9-21(11-12)17(23)16(22)20-13-4-3-8-19-10-13/h1-8,10H,9,11H2,(H,20,22) |
| InChIKey | MJGMZAQDQAWSBP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|