C16H22N4O2 — CID 155951044
1-(5-cyano-2-pyridinyl)-N-(2-methoxypropyl)piperidine-4-carboxamide (PubChem CID 155951044) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 1-(5-cyano-2-pyridinyl)-N-(2-methoxypropyl)piperidine-4-carboxamide.
| Compound Name | 1-(5-cyano-2-pyridinyl)-N-(2-methoxypropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 155951044 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 1-(5-cyano-2-pyridinyl)-N-(2-methoxypropyl)piperidine-4-carboxamide |
| SMILES | COC(C)CNC(=O)C1CCN(c2ccc(C#N)cn2)CC1 |
| InChI | InChI=1S/C16H22N4O2/c1-12(22-2)10-19-16(21)14-5-7-20(8-6-14)15-4-3-13(9-17)11-18-15/h3-4,11-12,14H,5-8,10H2,1-2H3,(H,19,21) |
| InChIKey | JEDLUDFCGDSNIS-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |