C18H28N4O3 — CID 155951889
1-[3-(1-aminoethyl)piperidin-1-yl]-2-[4-(furan-2-ylmethyl)piperazin-1-yl]ethane-1,2-dione (PubChem CID 155951889) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is 1-[3-(1-aminoethyl)piperidin-1-yl]-2-[4-(furan-2-ylmethyl)piperazin-1-yl]ethane-1,2-dione.
| Compound Name | 1-[3-(1-aminoethyl)piperidin-1-yl]-2-[4-(furan-2-ylmethyl)piperazin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 155951889 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | 1-[3-(1-aminoethyl)piperidin-1-yl]-2-[4-(furan-2-ylmethyl)piperazin-1-yl]ethane-1,2-dione |
| SMILES | CC(N)C1CCCN(C(=O)C(=O)N2CCN(Cc3ccco3)CC2)C1 |
| InChI | InChI=1S/C18H28N4O3/c1-14(19)15-4-2-6-22(12-15)18(24)17(23)21-9-7-20(8-10-21)13-16-5-3-11-25-16/h3,5,11,14-15H,2,4,6-10,12-13,19H2,1H3 |
| InChIKey | VGLKITWJNZTFIE-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 83.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|