C8H11F3N4O — CID 155952017
2,2,2-trifluoro-N-[3-(1-methyl-1,2,4-triazol-3-yl)propyl]acetamide (PubChem CID 155952017) has the molecular formula C8H11F3N4O and a molecular weight of 236.20 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[3-(1-methyl-1,2,4-triazol-3-yl)propyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[3-(1-methyl-1,2,4-triazol-3-yl)propyl]acetamide |
|---|---|
| PubChem CID | 155952017 |
| Molecular Formula | C8H11F3N4O |
| Molecular Weight | 236.20 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 2,2,2-trifluoro-N-[3-(1-methyl-1,2,4-triazol-3-yl)propyl]acetamide |
| SMILES | Cn1cnc(CCCNC(=O)C(F)(F)F)n1 |
| InChI | InChI=1S/C8H11F3N4O/c1-15-5-13-6(14-15)3-2-4-12-7(16)8(9,10)11/h5H,2-4H2,1H3,(H,12,16) |
| InChIKey | NUUNIOAICRDBTO-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.20 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|