C19H21N3O — CID 155952053
3-[[2-(3,5-dimethyl-2-pyridinyl)ethylamino]methyl]-1H-quinolin-2-one (PubChem CID 155952053) has the molecular formula C19H21N3O and a molecular weight of 307.40 g/mol. Its IUPAC name is 3-[[2-(3,5-dimethyl-2-pyridinyl)ethylamino]methyl]-1H-quinolin-2-one.
| Compound Name | 3-[[2-(3,5-dimethyl-2-pyridinyl)ethylamino]methyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 155952053 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 3-[[2-(3,5-dimethyl-2-pyridinyl)ethylamino]methyl]-1H-quinolin-2-one |
| SMILES | Cc1cnc(CCNCc2cc3ccccc3[nH]c2=O)c(C)c1 |
| InChI | InChI=1S/C19H21N3O/c1-13-9-14(2)17(21-11-13)7-8-20-12-16-10-15-5-3-4-6-18(15)22-19(16)23/h3-6,9-11,20H,7-8,12H2,1-2H3,(H,22,23) |
| InChIKey | RTUNQLKBVUQLEY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|