C13H11N5 — CID 15595236
2-N-naphthalen-2-yl-1,3,5-triazine-2,4-diamine (PubChem CID 15595236) has the molecular formula C13H11N5 and a molecular weight of 237.27 g/mol. Its IUPAC name is 2-N-naphthalen-2-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-naphthalen-2-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 15595236 |
| Molecular Formula | C13H11N5 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 2-N-naphthalen-2-yl-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1ncnc(Nc2ccc3ccccc3c2)n1 |
| InChI | InChI=1S/C13H11N5/c14-12-15-8-16-13(18-12)17-11-6-5-9-3-1-2-4-10(9)7-11/h1-8H,(H3,14,15,16,17,18) |
| InChIKey | OLZOYINAZDQNBY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |