C18H22ClN3OS — CID 155952897
1-(4-chloro-2-cyanophenyl)-4-methyl-N-(thietan-3-ylmethyl)piperidine-4-carboxamide (PubChem CID 155952897) has the molecular formula C18H22ClN3OS and a molecular weight of 363.91 g/mol. Its IUPAC name is 1-(4-chloro-2-cyanophenyl)-4-methyl-N-(thietan-3-ylmethyl)piperidine-4-carboxamide.
| Compound Name | 1-(4-chloro-2-cyanophenyl)-4-methyl-N-(thietan-3-ylmethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 155952897 |
| Molecular Formula | C18H22ClN3OS |
| Molecular Weight | 363.91 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 1-(4-chloro-2-cyanophenyl)-4-methyl-N-(thietan-3-ylmethyl)piperidine-4-carboxamide |
| SMILES | CC1(C(=O)NCC2CSC2)CCN(c2ccc(Cl)cc2C#N)CC1 |
| InChI | InChI=1S/C18H22ClN3OS/c1-18(17(23)21-10-13-11-24-12-13)4-6-22(7-5-18)16-3-2-15(19)8-14(16)9-20/h2-3,8,13H,4-7,10-12H2,1H3,(H,21,23) |
| InChIKey | ICJKTQVNEDIJHU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.91 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |